NSC 100227
N-(1-phenylethyl)benzamide
CAS: 3480-59-9
Molecular Formula: C15H15NO
NSC 100227 - Names and Identifiers
| Name | N-(1-phenylethyl)benzamide |
| Synonyms | NSC 100227 N-(1-phenylethyl)benzamide benzamide, N-(1-phenylethyl)- N-benzoyl-alpha-phenylethylamine |
| CAS | 3480-59-9 |
| InChI | InChI=1/C15H15NO/c1-12(13-8-4-2-5-9-13)16-15(17)14-10-6-3-7-11-14/h2-12H,1H3,(H,16,17) |
NSC 100227 - Physico-chemical Properties
| Molecular Formula | C15H15NO |
| Molar Mass | 225.29 |
| Density | 1.084g/cm3 |
| Melting Point | 128-129℃ (heptane ) |
| Boling Point | 422.8°C at 760 mmHg |
| Flash Point | 254.9°C |
| Vapor Presure | 2.34E-07mmHg at 25°C |
| Refractive Index | 1.578 |
NSC 100227 - Introduction
N-(1-phenylethyl)benzamide (N-(1-phenylethyl)benzamide) is an organic compound with the chemical formula C15H15NO.
Properties: N-(1-phenylethyl)benzamide is a colorless to slightly yellow crystalline solid. It is solid at room temperature and has a melting point of about 108-110°C. The compound is soluble in organic solvents such as ethanol, dimethylformamide and chloroform, and slightly soluble in water.
Purpose: N-(1-phenylethyl)benzamide are often used as reagents in organic synthesis reactions, such as precursors for the synthesis of amide compounds, molecules with fluorescent properties, and organometallic complexes.
Production Method: N-(1-phenylethyl)benzamide can be obtained by reacting phenethylamine with benzoyl chloride. The specific preparation steps are as follows:
1. mixing phenethylamine and trimethyltin oxide in anhydrous environment;
2. adding benzoyl chloride;
3. Stir the reaction at room temperature for about 12 hours;
4. Filtration afforded a solid product which was purified by cold ethanol crystallization.
Safety information: N-(1-phenylethyl)benzamide has low toxicity under general conditions, but it is still necessary to pay attention to safe operation. Avoid contact with skin and eyes during handling and storage. When used, a well-ventilated laboratory should be equipped and appropriate personal protective equipment, such as laboratory gloves and protective glasses, should be worn. In case of accidental ingestion or accidental contact, seek medical advice immediately.
Properties: N-(1-phenylethyl)benzamide is a colorless to slightly yellow crystalline solid. It is solid at room temperature and has a melting point of about 108-110°C. The compound is soluble in organic solvents such as ethanol, dimethylformamide and chloroform, and slightly soluble in water.
Purpose: N-(1-phenylethyl)benzamide are often used as reagents in organic synthesis reactions, such as precursors for the synthesis of amide compounds, molecules with fluorescent properties, and organometallic complexes.
Production Method: N-(1-phenylethyl)benzamide can be obtained by reacting phenethylamine with benzoyl chloride. The specific preparation steps are as follows:
1. mixing phenethylamine and trimethyltin oxide in anhydrous environment;
2. adding benzoyl chloride;
3. Stir the reaction at room temperature for about 12 hours;
4. Filtration afforded a solid product which was purified by cold ethanol crystallization.
Safety information: N-(1-phenylethyl)benzamide has low toxicity under general conditions, but it is still necessary to pay attention to safe operation. Avoid contact with skin and eyes during handling and storage. When used, a well-ventilated laboratory should be equipped and appropriate personal protective equipment, such as laboratory gloves and protective glasses, should be worn. In case of accidental ingestion or accidental contact, seek medical advice immediately.
Last Update：2024-04-10 22:29:15
